User:SamChem7
Jump to navigation
Jump to search
{{Chembox Identifiers2 | CASNo = 981-15-7 | PubChem = 72965 | SMILES = CC1=CC(=O)C(C2(C1CC3C45C2C(C(C(=C)C4CC(=O)O3)O)(OC5)O)C)O | InChIKey = WBBVXGHSWZIJST-RLQYZCPEBG }}
![]() | |
![]() | |
Names | |
---|---|
IUPAC name
missing
| |
Other names
2H-1,11c-(Epoxymethano)phenanthro(10,1-bc)pyran-5,10(3H,6ah)-dione, 1,3a,4,7,7a,11,11a,11b-octahydro-8,11a-β-dimethyl-3-methylene-1-α,2-β,11-β-trihydroxy-
| |
Properties | |
C20H24O7 | |
Molar mass | 376.40036 g/mol |
Appearance | missing |
Melting point | missing °C |
Boiling point | missing °C |
Insoluble | |
Vapor pressure | missing (@ 25 °C) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
missing text
References