User:Cryptic/Improper disambiguation redirects/9
Jump to navigation
Jump to search
This table is generated by querying the database replica and is periodically updated by SDZeroBot.
Edits made to this page will be removed on the next update!
<< Previous page || Next page >>
title | creation |
---|---|
⤷El Dorado Cinema(Oslo) | 2010-01-02T19:29:59.000Z |
⤷Juno Award for Classical Album of the Year - Large Ensemble or Soloist(s) with Large Ensemble Accompaniment | 2009-12-31T21:38:36.000Z |
⤷Chartered Institute of Logistics and Transport in the UK - CILT(UK) | 2009-12-31T19:56:31.000Z |
Niobium(V) fluoride | 2009-12-30T06:32:40.000Z |
⤷Benzo(e)fluoranthene | 2009-12-29T13:03:15.000Z |
⤷Lp(a) | 2009-12-29T12:36:17.000Z |
⤷Mayanur(tamilnadu) | 2009-12-28T18:37:03.000Z |
⤷Get Out!(album) | 2009-12-27T05:40:40.000Z |
⤷Garz(Rügen) | 2009-12-25T15:29:32.000Z |
⤷USS Fairview (PCE(R)-850) | 2009-12-25T12:51:36.000Z |
⤷Alto Paraná(city) | 2009-12-25T06:33:57.000Z |
⤷Sin(x)/x | 2009-12-24T03:32:55.000Z |
⤷Mendocino Homeland(The Lookouts ep) | 2009-12-21T15:30:11.000Z |
⤷K-OTIC(Thai Group) | 2009-12-20T22:02:26.000Z |
⤷42 USC 652(k) | 2009-12-20T11:02:22.000Z |
42 U.S.C. § 652(k) | 2009-12-20T10:10:02.000Z |
⤷AUCP(b) | 2009-12-19T18:04:20.000Z |
⤷W(2) | 2009-12-18T19:57:28.000Z |
⤷W(1) | 2009-12-17T11:52:51.000Z |
Fox(film) | 2009-12-17T02:42:47.000Z |
Bond(z) | 2009-12-15T20:19:22.000Z |
⤷Rory Gallagher(Gaelic Footballer) | 2009-12-15T14:53:24.000Z |
⤷Fauj Mein Mauj (2009)(Film) | 2009-12-15T09:25:58.000Z |
⤷2-(1-hexyloxyethyl)-2-devinyl pyropheophorbide-a | 2009-12-14T20:10:28.000Z |
⤷Down the Rabbit Hole(song) | 2009-12-14T12:32:21.000Z |
⤷SUCI(C) | 2009-12-12T11:40:26.000Z |
2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a | 2009-12-12T03:52:03.000Z |
⤷Tom Drake(wrestler, politician, coach) | 2009-12-11T16:45:56.000Z |
⤷James Johnston(Australian Idol) | 2009-12-11T06:20:34.000Z |
⤷Receptacle(botany) | 2009-12-10T18:10:28.000Z |
⤷Poly(methyl-methacrylate) | 2009-12-08T19:12:55.000Z |
⤷Before the storm(Niley) | 2009-12-05T19:44:43.000Z |
⤷Rai(Indian Title) | 2009-12-04T15:37:08.000Z |
⤷Gf(x) (band) | 2009-12-04T15:23:49.000Z |
⤷Iron(II)sulfide | 2009-12-03T21:57:52.000Z |
⤷Savior(song) | 2009-12-03T19:04:04.000Z |
⤷2,2-bis(4-glycidyloxyphenyl)propane | 2009-12-03T19:03:25.000Z |
⤷Ƒ(x) | 2009-12-02T21:55:24.000Z |
⤷Chromium(III) sulphate | 2009-12-02T11:03:56.000Z |
⤷PC(AP) | 2009-12-02T10:27:19.000Z |
⤷F(x) (Female Group) | 2009-12-01T15:11:27.000Z |
⤷1-(4-Methoxyphenyl)piperazine | 2009-12-01T09:25:07.000Z |
⤷On the Daltons' Trail(Lucky Luke) | 2009-12-01T08:58:59.000Z |
⤷Daisy Town(Lucky Luke) | 2009-12-01T08:57:14.000Z |
⤷The Ballad of the Daltons and other stories(Lucky Luke) | 2009-12-01T08:56:49.000Z |
⤷Claude Kelly(Songwriter) | 2009-12-01T00:33:57.000Z |
⤷2,5-dimethoxy-4-(2-fluoroethyl)amphetamine | 2009-11-30T06:11:06.000Z |
⤷Kokri Vehniwal(Moga) | 2009-11-29T16:43:58.000Z |
⤷CVR(T) Scimitar | 2009-11-29T14:58:52.000Z |
⤷CVR(T) Scorpion | 2009-11-29T14:57:54.000Z |
⤷National Highway 54B (India)(old numbering) | 2009-11-29T14:43:59.000Z |
⤷National Highway 47C (India)(old numbering) | 2009-11-29T14:01:08.000Z |
⤷National Highway 11C (India)(old numbering) | 2009-11-29T13:52:21.000Z |
⤷National Highway 4C (India)(old numbering) | 2009-11-29T13:44:12.000Z |
⤷National Highway 2C (India)(old numbering) | 2009-11-29T13:37:02.000Z |
⤷National Highway 2B (India)(old numbering) | 2009-11-29T13:30:52.000Z |
⤷Sooner or Later(Breaking Benjamin song) | 2009-11-29T07:03:10.000Z |
⤷Utz Rothe,(Austrian Artist) | 2009-11-28T23:13:02.000Z |
⤷Spieker Aquatics Center(UCLA) | 2009-11-28T19:19:29.000Z |
⤷Od(1) | 2009-11-26T20:45:38.000Z |
Iron(II) | 2009-11-26T01:39:53.000Z |
⤷ΚΚΕ(μ-λ) | 2009-11-25T20:00:26.000Z |
⤷KKE(m-l) | 2009-11-25T19:58:23.000Z |
Gold(I) bromide | 2009-11-24T19:55:49.000Z |
⤷Vigilance(album) | 2009-11-24T17:58:12.000Z |
⤷Rizen(gospel group) | 2009-11-24T03:07:28.000Z |
Praseodymium(III) sulfate | 2009-11-24T02:24:46.000Z |
⤷Mike Compton(catcher) | 2009-11-23T21:51:38.000Z |
⤷Trioctylmethylammonium bis(trifluoromethyl-sulfonyl)imide | 2009-11-23T21:16:27.000Z |
⤷Shivalli(village) | 2009-11-23T16:56:28.000Z |
⤷KPU(o) | 2009-11-22T19:11:54.000Z |
⤷Poly(ethylene oxide) | 2009-11-22T05:58:25.000Z |
⤷Poly(ethylene terephthalate) | 2009-11-22T05:56:36.000Z |
⤷СДПУ(о) | 2009-11-21T17:55:18.000Z |
⤷USS PCE(R)-853 | 2009-11-19T22:08:41.000Z |
⤷USS PCE(R)-852 | 2009-11-19T22:08:33.000Z |
⤷PF6(-) | 2009-11-19T16:35:06.000Z |
⤷1-(1-Phenylcyclohexyl)-4-hydroxypiperidine | 2009-11-19T16:15:49.000Z |
⤷The National Stadium(Jamaica) | 2009-11-18T20:41:37.000Z |
⤷1,1'-azobis(N,N-dimethylformamide) | 2009-11-17T14:05:44.000Z |
⤷Azodicarboxylic acid bis(dimethylamide) | 2009-11-17T14:05:34.000Z |
⤷Gallium(III) arsenide | 2009-11-16T05:53:01.000Z |
⤷Ramling(Old Shirur) | 2009-11-15T19:43:43.000Z |
⤷Tonight(TobyMac album) | 2009-11-15T08:02:06.000Z |
⤷Divertimento No. 11(Mozart) | 2009-11-14T18:46:08.000Z |
⤷AlLibis(binaphthoxide) | 2009-11-11T20:14:40.000Z |
⤷Mike Austin(swimmer) | 2009-11-11T10:04:17.000Z |
Bundesliga(wrestling) | 2009-11-10T12:46:49.000Z |
⤷Eddie Freeman(musician) | 2009-11-09T18:05:08.000Z |
⤷RSP(B) | 2009-11-09T17:24:28.000Z |
⤷Salmson-(Canton-Unne) Z9 | 2009-11-09T07:39:11.000Z |
⤷Good morning(Chamillionaire single) | 2009-11-08T20:51:10.000Z |
⤷A1(M) motorway (Great Britain) | 2009-11-08T08:39:28.000Z |
4-(γ-Glutamylamino)butanoic acid | 2009-11-07T21:21:36.000Z |
⤷Americas Best Dance Crew(season 5) | 2009-11-07T20:56:40.000Z |
⤷Zeta(3) | 2009-11-07T03:24:50.000Z |
⤷Guo Yuan(Zen monk) | 2009-11-05T03:50:46.000Z |
⤷National Highway 28C (India)(old numbering) | 2009-11-04T22:09:32.000Z |
⤷National Highway 26A (India)(old numbering) | 2009-11-04T21:47:56.000Z |
⤷BNC(bank) | 2009-11-04T17:32:59.000Z |
⤷Police Quarters(the film) | 2009-11-04T14:21:30.000Z |
⤷AKASH(missile) | 2009-11-04T11:03:23.000Z |
⤷UCPN(M) | 2009-11-04T07:00:40.000Z |
⤷Bagpipes(How I Met Your Mother) | 2009-11-03T00:13:52.000Z |
⤷Epicatechin-(2β→7,4β→8)-epicatechin | 2009-11-02T16:26:20.000Z |
⤷Oligo(U) tail | 2009-11-02T14:36:45.000Z |
⤷Poly(U) tail | 2009-11-02T14:36:09.000Z |
⤷Finnegan's Wake(Homicide: Life on the Street) | 2009-11-02T13:20:24.000Z |
⤷Fallen Heroes(Homicide: Life on the Street) | 2009-11-02T13:20:21.000Z |
⤷CECT(mobile phone brand) | 2009-11-02T10:14:19.000Z |
⤷N-ethyl-5-(trifluoromethyl)-2,3-dihydro-1H-inden-2-amine | 2009-10-31T21:16:36.000Z |
⤷Grantown-on-Spey(West) railway station | 2009-10-30T22:54:21.000Z |
⤷Addictive(Band) | 2009-10-30T07:33:33.000Z |
⤷The Traitor(novel) | 2009-10-29T21:39:07.000Z |
⤷What the Dog Saw : And Other Adventures(book) | 2009-10-29T19:49:31.000Z |
⤷SE(n) | 2009-10-29T17:42:47.000Z |
⤷SE(2) | 2009-10-29T17:41:17.000Z |
⤷Grue-(monster) | 2009-10-28T13:49:00.000Z |
⤷Siege of Tunis(Mercenary War) | 2009-10-28T13:22:59.000Z |
⤷Atsede Kidanu(Mrs) | 2009-10-26T06:24:13.000Z |
⤷Epicatechin-(4β→8,2β→O→7)-entcatechin-(4β-8)-catechin | 2009-10-25T10:01:17.000Z |
⤷Veze(Baise) | 2009-10-25T03:14:27.000Z |
⤷Zeta(2) | 2009-10-25T01:44:55.000Z |
⤷Libx(graphics library) | 2009-10-25T00:52:28.000Z |
⤷Epiafzelechin-(4beta-8,2beta-0-7)-epiafzelechin-(4beta-8)-afzelechin | 2009-10-24T13:01:29.000Z |
⤷Art. 123(2) | 2009-10-24T09:19:24.000Z |
⤷Vibes(Soundtrack) | 2009-10-24T03:27:11.000Z |
⤷N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine | 2009-10-23T16:55:32.000Z |
⤷1-(2-nitro-1-imidazolyl)-3-methoxy-2-propanol | 2009-10-23T14:49:56.000Z |
⤷12(S)-hydroxyeicosatetraenoic acid | 2009-10-23T14:00:42.000Z |
⤷12(S)-HETE | 2009-10-23T14:00:36.000Z |
⤷(5Z,8Z,10E,14Z)-(12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoate | 2009-10-23T13:56:14.000Z |
Are(A)zione | 2009-10-22T19:58:30.000Z |
⤷(E)-3-(4-dimethylaminophenyl)prop-2-enal | 2009-10-22T18:33:56.000Z |
⤷USS Nightingale (MSC(O)-50) | 2009-10-22T15:30:42.000Z |
⤷Rohini Village(West Bengal) | 2009-10-22T01:59:29.000Z |
⤷Paschim Champaran(Lok Sabha constituency) | 2009-10-21T05:49:53.000Z |
Protactinium(IV) oxide | 2009-10-20T13:56:56.000Z |
⤷Kaba(The shiva Temple) | 2009-10-20T12:00:35.000Z |
⤷Algiers expedition(1541) | 2009-10-19T20:07:29.000Z |
⤷Cercal do Alentejo(Santiago do Cacém) | 2009-10-19T19:55:10.000Z |
⤷U(2) | 2009-10-19T02:29:43.000Z |
⤷The Last Night(song) | 2009-10-19T01:17:18.000Z |
⤷Ludwig(Germany) | 2009-10-19T01:08:43.000Z |
⤷FLEC(Lopes) | 2009-10-18T15:34:52.000Z |
⤷Gpp(NH)p | 2009-10-16T20:53:44.000Z |
⤷VR(PC) | 2009-10-16T19:28:27.000Z |
Omerta(mmorpg) | 2009-10-16T09:22:32.000Z |
⤷1-(2-pyrimidinyl)-piperazine | 2009-10-15T04:44:40.000Z |
⤷1-(2-Pyrimidinyl)-piperazine | 2009-10-15T04:44:23.000Z |
⤷1-(2-pyrimidinyl)piperazine | 2009-10-15T04:37:45.000Z |
T(1) theorem | 2009-10-15T03:42:27.000Z |
⤷Paul Foster(footballer) | 2009-10-15T01:17:34.000Z |
⤷Regret(LeToya song) | 2009-10-14T20:23:06.000Z |
⤷Wembley Stadium(1923) | 2009-10-14T00:32:08.000Z |
⤷Where Do I Begin (remix)(Shirley Bassey single) | 2009-10-13T19:43:59.000Z |
⤷SE(3) | 2009-10-13T12:33:50.000Z |
⤷2,3-(S)-hexahydroxydiphenoyl-4,6-(S,S)-gallagyl-D-glucose | 2009-10-12T13:19:09.000Z |
⤷Moon of the Spider(novel) | 2009-10-12T08:20:31.000Z |
⤷Bass(Mega Man) | 2009-10-12T00:17:57.000Z |
⤷Edith's 50th Birthday(All in the Family) | 2009-10-11T10:06:18.000Z |
⤷Fort Lyon(California) | 2009-10-08T21:42:12.000Z |
⤷European Cup for clubs(korfball) | 2009-10-06T23:22:45.000Z |
⤷Catechin-(4α→6)-epicatechin | 2009-10-06T14:11:27.000Z |
⤷Catechin-(4α→6)-catechin | 2009-10-06T14:06:24.000Z |
⤷Epicatechin-(4β → 6)-epicatechin | 2009-10-06T13:58:16.000Z |
⤷Catechin-(4α→8)-epicatechin | 2009-10-06T13:47:56.000Z |
⤷Guo Yuan(Three Kingdoms) | 2009-10-06T09:48:59.000Z |
⤷(2S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol | 2009-10-05T17:15:29.000Z |
⤷Om(Kannada film) | 2009-10-05T15:29:00.000Z |
⤷(2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol | 2009-10-05T07:11:14.000Z |
⤷Patrick Wolf(footballer) | 2009-10-04T12:05:37.000Z |
⤷Iṣṭa-deva(tā) | 2009-10-03T20:10:30.000Z |
⤷Nagpur West(Assembly constituency) | 2009-10-03T19:22:57.000Z |
⤷Akola West(Assembly constituency) | 2009-10-01T11:43:02.000Z |
⤷Jalgaon(Jamod) | 2009-10-01T11:14:58.000Z |
⤷Jalgaon(Jamod) (Assembly constituency) | 2009-09-30T12:37:26.000Z |
Jennifer's Body(film) | 2009-09-30T05:08:04.000Z |
⤷D-Con(Gaming Convention) | 2009-09-28T23:15:34.000Z |
⤷Cheshunt F.C.(1880-1931) | 2009-09-28T19:20:09.000Z |
⤷Dangoh Khurd, Pirthipur, Una(HP) | 2009-09-28T15:29:48.000Z |
⤷OS(OSD) | 2009-09-28T13:42:19.000Z |
⤷Salem Witches(NEL) | 2009-09-27T19:32:28.000Z |
⤷Jeff Schroeder(Musician) | 2009-09-26T23:38:47.000Z |
⤷My Kinda Girl(Raghav) | 2009-09-26T05:48:20.000Z |
⤷Epicatechin-(4β→8)-catechin | 2009-09-26T05:46:51.000Z |
USS LSM(R)-188 | 2009-09-26T01:26:52.000Z |
⤷Season 1(The Cleveland Show) | 2009-09-25T18:49:32.000Z |
⤷Yaaruku Yaaro(Tamil Film) | 2009-09-25T18:24:36.000Z |
⤷MIR(c) | 2009-09-24T10:11:39.000Z |
⤷Ahmednagar City(Assembly constituency) | 2009-09-22T18:37:35.000Z |
⤷Malavika(singer) | 2009-09-22T10:42:56.000Z |
⤷O-(beta-hydroxyethyl)-rutosides | 2009-09-21T11:51:09.000Z |
⤷Fire It Up(Thousand Foot Krutch) | 2009-09-21T10:15:52.000Z |
⤷0-(beta-hydroxyethyl)-rutosides | 2009-09-21T09:44:09.000Z |
Assassin(s) | 2009-09-20T18:33:54.000Z |
⤷2-(((3R,4S)-1-methyl-4-(4-chlorophenyl)piperidin-3-yl)methylthio)-N-isopropylacetamide | 2009-09-19T23:00:51.000Z |
⤷C4H9(C6H4(OH)COO) | 2009-09-19T06:36:15.000Z |
⤷Aadat(Indian Edition) | 2009-09-18T21:37:57.000Z |
⤷Robert Herring(aviator) | 2009-09-18T20:47:47.000Z |
⤷Combined Arms(Computer Game) | 2009-09-18T20:31:55.000Z |
⤷Sqrt(5) | 2009-09-17T18:47:09.000Z |
⤷Sqrt(3) | 2009-09-17T18:43:52.000Z |
⤷2β-((3,4-Methylenedioxyphenoxy)methyl)-3α-(4-fluorophenyl)nortropane | 2009-09-17T17:34:11.000Z |
⤷Ga(NO3)3 | 2009-09-17T13:16:33.000Z |
⤷4',5-Dihydro-6-methoxy-7-(o-glucoside)isoflavone | 2009-09-16T19:15:54.000Z |
⤷High School Confidential(Sit Down, Shut Up) | 2009-09-16T17:30:21.000Z |
⤷688(i) Hunter/Killer | 2009-09-16T14:31:29.000Z |
⤷Foxbridge(horse) | 2009-09-16T11:50:15.000Z |
⤷5,7-dihydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxychromen-4-one | 2009-09-15T19:29:20.000Z |
⤷5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one | 2009-09-15T19:19:29.000Z |
⤷O-(beta-Hydroxyethyl)diosmin | 2009-09-15T14:03:20.000Z |
⤷Helen Money(cello) | 2009-09-14T21:48:20.000Z |
⤷Ganesh(Just Ganesh) | 2009-09-14T12:40:09.000Z |
⤷Copa America(Indoor) | 2009-09-14T09:07:50.000Z |
⤷Robert F. Wagner Jr.(Deputy Mayor) | 2009-09-14T02:38:58.000Z |
⤷Ryukyu News(paper) | 2009-09-13T08:10:19.000Z |
⤷The Hangover 2(film) | 2009-09-13T02:31:34.000Z |
⤷Sinc(x) | 2009-09-13T01:06:33.000Z |
⤷XRS-2200(rocket engine) | 2009-09-11T21:04:10.000Z |
⤷The third generation(2009) | 2009-09-11T14:38:40.000Z |
⤷Walt Disney International(India) Pvt. Ltd. | 2009-09-11T09:33:05.000Z |
⤷Β-D-xylosyl-(1→2)-β-D-glucose | 2009-09-10T14:49:33.000Z |
⤷Hornet's Nest(Doctor Who) | 2009-09-10T02:49:57.000Z |
⤷We Are Klang(TV Series) | 2009-09-09T03:15:43.000Z |
⤷Measure of a Man(Jack Ingram song) | 2009-09-08T21:38:41.000Z |
⤷Kofi Adu(Agya Koo) | 2009-09-08T19:17:33.000Z |
⤷Aladdin(film) | 2009-09-07T22:31:55.000Z |
⤷3-(Galactosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride | 2009-09-07T17:34:27.000Z |
⤷Long March 3B(A) | 2009-09-07T13:11:33.000Z |
⤷Tony Dixon(American football) | 2009-09-06T16:27:41.000Z |
⤷Mandy(Jonas Brothers Song) | 2009-09-06T08:45:04.000Z |
⤷1-(2-Naphthyl)-2-aminopropane | 2009-09-06T00:58:47.000Z |
⤷Magnus(II), son of Gille Brigte | 2009-09-05T18:03:00.000Z |
Bis(pinacolato)diboron | 2009-09-05T01:18:30.000Z |
⤷Keep It Real(Jonas Brothers song) | 2009-09-04T22:59:01.000Z |
⤷2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol | 2009-09-04T06:33:00.000Z |
Zirconium(IV) sulfate | 2009-09-03T23:26:40.000Z |
⤷Consumer(food chain) | 2009-09-03T20:45:56.000Z |
⤷2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol | 2009-09-03T07:44:37.000Z |
USS LSM(R)-199 | 2009-09-02T22:21:20.000Z |
⤷National Highway 24B (India)(old numbering) | 2009-09-02T21:15:19.000Z |
C6H4(OH)2 | 2009-09-02T20:36:08.000Z |
⤷National Highway 79A (India)(old numbering) | 2009-09-02T14:33:19.000Z |
⤷National Highway 11B (India)(old numbering) | 2009-09-02T13:34:25.000Z |
⤷ORPC(M-L) | 2009-09-02T02:41:04.000Z |
⤷C6H2(OH)3COOH | 2009-09-01T17:30:23.000Z |
⤷Eclipse phase(Game) | 2009-09-01T16:49:12.000Z |
⤷(-)-2β-Carbocyclobutoxy-3β-(4-methylphenyl)tropane | 2009-09-01T16:19:38.000Z |
⤷2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxychromenylium-3,5-diol | 2009-09-01T07:29:29.000Z |
⤷USS LSM(R) 195 | 2009-09-01T02:50:24.000Z |
USS LSM(R)-195 | 2009-09-01T01:41:31.000Z |
USS LSM(R)-198 | 2009-09-01T01:23:59.000Z |
USS LSM(R)-197 | 2009-09-01T01:08:35.000Z |
⤷F(x) (South Korean group) | 2009-08-31T19:32:01.000Z |
Dollaseite-(Ce) | 2009-08-31T18:15:40.000Z |
⤷USS ARD(BS)-20 | 2009-08-30T18:44:29.000Z |
⤷Exegesis(Millennium) | 2009-08-30T10:36:00.000Z |
⤷(2R-trans)-3-((6-Deoxy-alpha-L-mannopyranosyl)oxy)-2-(3,4- dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one | 2009-08-30T06:35:32.000Z |
F(x) (musical group) | 2009-08-30T03:22:50.000Z |
⤷Kelhauri(chachai) | 2009-08-29T22:33:26.000Z |
USS LSM(R)-196 | 2009-08-29T21:58:27.000Z |
⤷Vacuity(Band) | 2009-08-29T19:19:23.000Z |
USS LSM(R)-194 | 2009-08-29T16:23:13.000Z |
⤷C6H5CH(CH3)NH2 | 2009-08-29T13:29:55.000Z |
⤷USS LSM(R) 193 | 2009-08-28T07:26:50.000Z |
⤷Thomas William Murphy (1935-1992)(Associate Justice American Samoa 1980-1987) | 2009-08-28T06:48:57.000Z |
USS LSM(R)-192 | 2009-08-28T04:16:57.000Z |
⤷Sqrt(2) | 2009-08-28T02:45:49.000Z |
⤷Bigger Than The Mayor(album) | 2009-08-28T02:34:19.000Z |
⤷Arrondissement of Château-Chinon(Ville) | 2009-08-27T20:33:31.000Z |
⤷(2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | 2009-08-27T17:19:02.000Z |
USS LSM(R)-193 | 2009-08-27T02:03:48.000Z |
⤷Tropical Storm Danny(2009) | 2009-08-27T00:58:51.000Z |
⤷Chal Chalein(2009 film) | 2009-08-26T10:59:35.000Z |
⤷2-(3,4-dihydroxyphenyl)chromenylium-3,7-diol chloride | 2009-08-26T06:39:26.000Z |
⤷2-(3-hydroxy-4-methoxyphenyl)chromenylium-5,7-diol chloride | 2009-08-25T18:34:35.000Z |
⤷2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol | 2009-08-25T17:49:45.000Z |
⤷2-(3,4-dihydroxyphenyl)chromenylium-5,7-diol | 2009-08-25T15:43:08.000Z |
⤷2-(3,4-Dihydroxy-phenyl)-5,7-dihydroxy-chromenylium | 2009-08-25T15:39:30.000Z |
⤷2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium | 2009-08-25T15:39:12.000Z |
⤷5,7-dihydroxy-2-(4-hydroxyphenyl)benzopyrilium chloride | 2009-08-25T15:16:39.000Z |
⤷7-hydroxy-3-(4-methoxyphenyl)chromen-4-one | 2009-08-25T12:23:16.000Z |
⤷Biochanin A 7-O-(6-O-malonyl-beta-D-glucoside) | 2009-08-25T09:21:45.000Z |
⤷2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose | 2009-08-25T07:39:51.000Z |
⤷USS LSM(R) 191 | 2009-08-25T04:43:28.000Z |
⤷2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one | 2009-08-24T18:12:36.000Z |
⤷5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one | 2009-08-24T17:37:15.000Z |
⤷Video Phone(Beyonce Knowles song) | 2009-08-24T15:43:44.000Z |
⤷2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one | 2009-08-24T12:46:02.000Z |
⤷5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxychromen-4-one | 2009-08-24T12:06:34.000Z |
⤷2-(3,4-dimethoxyphenyl)-3-hydroxy-5,6,7,8-tetramethoxychromen-4-one | 2009-08-24T11:32:50.000Z |
⤷3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one | 2009-08-24T09:10:51.000Z |
⤷3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | 2009-08-24T08:34:08.000Z |
⤷3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one | 2009-08-24T08:27:10.000Z |
⤷Pudukkudi West(srivaikuntam) | 2009-08-24T08:10:56.000Z |
⤷3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one | 2009-08-24T08:03:44.000Z |
USS LSM(R)-191 | 2009-08-23T23:02:51.000Z |
⤷(E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one | 2009-08-23T19:22:38.000Z |
⤷2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one | 2009-08-23T13:51:07.000Z |
⤷Tytus(Masters of the Universe) | 2009-08-23T13:09:33.000Z |
⤷X( | 2009-08-22T17:18:28.000Z |
⤷Copenhagen Convention(bridge) | 2009-08-22T16:23:37.000Z |
⤷7-(β-D-glucopyranuronosyloxy)-5,6-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | 2009-08-21T08:13:58.000Z |
⤷7.62 cm PaK 36(r) | 2009-08-20T20:25:51.000Z |
⤷Almost Home(Evergreen Terrace album) | 2009-08-20T17:33:19.000Z |
USS LSM(R)-190 | 2009-08-20T16:01:13.000Z |
⤷Sulphur(IV) oxide | 2009-08-20T10:28:42.000Z |
⤷That Was Yesterday(Foreigner song) | 2009-08-20T07:22:25.000Z |
⤷Proddatur(Assembly constituency) | 2009-08-20T05:46:37.000Z |
⤷Blue Morning, Blue Day(Foreigner song) | 2009-08-20T05:36:48.000Z |
⤷2β-((3,4-Methylenedioxy)phenoxy)methyl)-3α-(4-fluorophenyl)tropane | 2009-08-19T12:36:28.000Z |
⤷Made Of Stone(play) | 2009-08-19T04:52:04.000Z |
S. Rajendran (CPI(M) politician) | 2009-08-19T00:39:31.000Z |
⤷Operater(A Girl Like Me) | 2009-08-18T20:29:37.000Z |
⤷Mario Mendez(futbolista panameño) | 2009-08-18T16:16:59.000Z |
⤷Chiloda(Naroda) | 2009-08-16T13:11:49.000Z |
⤷St.Martin's Engineering college,Dhulapally(smec) | 2009-08-15T09:20:10.000Z |
⤷A Thousand Nights(album) | 2009-08-15T08:12:55.000Z |
⤷(-)-2β-Carbomethoxy-3β-(4-fluorophenyl)tropane | 2009-08-14T20:28:58.000Z |
⤷Raw(Juvenile album) | 2009-08-14T10:19:57.000Z |
⤷Quake(Aftershock) | 2009-08-13T21:19:33.000Z |
⤷Lake Michigan Conference(Michigan) | 2009-08-13T15:36:18.000Z |
⤷CPI(ML) Unity Initiative | 2009-08-13T09:58:51.000Z |
⤷Bring Me To Life(Thousand Foot Krutch) | 2009-08-12T04:42:52.000Z |
⤷Sodium tetrachloropalladate(II) | 2009-08-12T01:40:47.000Z |
⤷Noble College(Autonomous), Machilipatnam | 2009-08-11T13:00:04.000Z |
⤷Redundant(play) | 2009-08-11T05:08:02.000Z |
⤷Send it on(song) | 2009-08-10T19:57:35.000Z |
⤷Vmsplice() exploit | 2009-08-10T13:38:13.000Z |
⤷25(OH)D | 2009-08-10T03:05:44.000Z |
⤷(-)-Methyl-1-methyl-4β-(2-naphthyl)piperidine-3β-carboxylate | 2009-08-10T02:04:34.000Z |
⤷2-Butyl-3-(p-tolyl)quinuclidine | 2009-08-10T01:20:36.000Z |
⤷Winter Wonderland(album) | 2009-08-08T23:45:17.000Z |
⤷Tribute(album) | 2009-08-08T23:35:18.000Z |
⤷Happy Feet(album) | 2009-08-08T23:28:19.000Z |
⤷Like a Lover(album) | 2009-08-08T23:24:37.000Z |
⤷(-)-2β-Carbomethoxy-3β-(4-methylphenyl)tropane | 2009-08-08T13:55:50.000Z |
⤷(-)-2β-Carbomethoxy-3β-(4-bromophenyl)tropane | 2009-08-08T13:53:40.000Z |
⤷(-)-2β-Carbomethoxy-3β-(4-chlorophenyl)tropane | 2009-08-08T13:51:52.000Z |
⤷Tetrakis(dimethylamino)titanium | 2009-08-08T03:05:59.000Z |
⤷Tetrakis(dimethylamino)titanium(IV) | 2009-08-08T02:44:14.000Z |
⤷Zhao Peng(football player) | 2009-08-07T22:42:32.000Z |
⤷The Business of Dying(Novel) | 2009-08-07T17:04:44.000Z |
⤷Hats Off(EP) | 2009-08-07T06:07:37.000Z |
⤷Reborn(Avalon album) | 2009-08-07T05:59:00.000Z |
⤷5-(2-Propylamino)indane | 2009-08-06T15:06:03.000Z |
⤷5-(2-propylamino)indane | 2009-08-06T15:05:49.000Z |
⤷1-(5-Indanyl)-2-aminopropane | 2009-08-06T15:02:19.000Z |
⤷NordicTrack(MN based company) | 2009-08-06T14:10:52.000Z |
⤷Shri Shankaracharya College of Engineering and Technology(SSCET) | 2009-08-06T07:25:45.000Z |
⤷Bhilai Institute Of Technology(BIT-Durg) | 2009-08-06T07:24:05.000Z |
⤷5-(3,4-Methylenedioxyphenyl)-2,4-pentadienoyl-2-piperidine | 2009-08-06T04:46:21.000Z |
⤷4,5-(Methylenedioxyphenyl)-3-methoxy-2-propene | 2009-08-06T04:45:51.000Z |
⤷D-Lysergic acid N-(α-hydroxyethyl)amide | 2009-08-06T02:33:38.000Z |
⤷3-amino-2-methyl-1,1-di(phenyl)propan-1-ol | 2009-08-06T02:07:01.000Z |
⤷1-(1-(1-Benzothiophen-2-yl)cyclohexyl)piperidine | 2009-08-06T01:03:28.000Z |
⤷Carmel High School(Nagercoil) | 2009-08-05T23:11:56.000Z |
Benzo(c)thiophene | 2009-08-05T21:25:41.000Z |
Benzo(k)fluoranthene | 2009-08-05T21:19:16.000Z |
Benzo(j)fluoranthene | 2009-08-05T21:13:49.000Z |
Benzo(ghi)perylene | 2009-08-05T21:07:09.000Z |
Benzo(e)pyrene | 2009-08-05T21:01:30.000Z |
⤷Benzo(b)fluoranthene | 2009-08-05T20:52:59.000Z |
Benzo(c)phenanthrene | 2009-08-05T20:46:44.000Z |
⤷Duele(Chenoa´s single) | 2009-08-05T20:43:24.000Z |
⤷Benzo(b)phenanthrene | 2009-08-05T20:35:40.000Z |
Benz(a)anthracene | 2009-08-05T20:34:47.000Z |
⤷Avatar: The Last Airbender(Kings Island) | 2009-08-05T18:27:05.000Z |
⤷Dear Agony(album) | 2009-08-05T00:01:20.000Z |
⤷Bis(triphenylphosphine)palladium(II) chloride | 2009-08-04T18:17:18.000Z |
⤷(-)-1-(Benzofuran-2-yl)-2-propylaminopentane | 2009-08-03T15:35:33.000Z |
⤷3,4-(Methylenedioxyphenyl)-1-propanone | 2009-08-03T10:26:57.000Z |
⤷Aladin(2009 film) | 2009-08-03T00:05:29.000Z |
⤷Dichlorobis(triphenylphosphine)palladium(II) | 2009-08-02T19:19:04.000Z |
⤷John Williams(bishop) | 2009-08-01T17:55:06.000Z |
⤷3,4-(Methylenedioxyphenyl)-2-propene | 2009-07-31T09:23:02.000Z |
⤷3,4-(Methylenedioxyphenyl)-1-propene | 2009-07-31T09:20:16.000Z |
⤷3-(3,4-(Methylenedioxy)phenyl)-1-propene | 2009-07-31T09:18:02.000Z |
⤷3,4-(methylenedioxyphenyl)-2-propanone | 2009-07-31T09:00:39.000Z |
⤷Nicholas Rush(Stargate) | 2009-07-31T08:26:40.000Z |
⤷2-(5-methoxy-2-methyl-H-indol-3-yl)-N,N-dimethylethanamine | 2009-07-31T03:15:06.000Z |
⤷Blue jersey(Vuelta a España) | 2009-07-29T21:43:14.000Z |
⤷2001: A Space Odyssey(film) | 2009-07-28T12:15:42.000Z |
⤷Cherry Hill(Amusement Park) | 2009-07-27T22:38:19.000Z |
⤷(-)-2β-Carbomethoxy-3β-(4-iodophenyl)tropane | 2009-07-25T20:12:01.000Z |
⤷Methylenedioxy-N-(2-hydroxyethyl)amphetamine | 2009-07-25T03:19:55.000Z |
⤷3,4-Methylenedioxy-N-(2-hydroxyethyl)amphetamine | 2009-07-25T03:18:54.000Z |
⤷(-)-1-(benzofuran-2-yl)-2-propylaminopentane | 2009-07-23T03:36:18.000Z |
⤷Poly(chloroethanediyl) | 2009-07-22T19:42:26.000Z |
⤷Hitler(Malayalam) | 2009-07-22T01:25:50.000Z |
⤷Benzo(a)pyrazine | 2009-07-21T14:47:47.000Z |
⤷For Eric Delko (2)(CSI: Miami) | 2009-07-20T19:52:14.000Z |
⤷Soil(Band) | 2009-07-20T15:50:09.000Z |
⤷Bismuth(III) fluoride | 2009-07-20T14:22:19.000Z |
Mercury(I) nitrate | 2009-07-19T19:42:19.000Z |
⤷David Willison(pianist) | 2009-07-19T19:18:49.000Z |
⤷Son of a Son of a Sailor(song) | 2009-07-19T02:09:02.000Z |
⤷Strawweight(MMA) | 2009-07-18T15:28:47.000Z |
⤷4-(4-methylphenyl)-4-oxobutanoic acid | 2009-07-16T20:51:48.000Z |
⤷David Brand(footballer) | 2009-07-15T19:48:36.000Z |
⤷CPI(ML) Liberation | 2009-07-14T20:11:30.000Z |
⤷Kharapu(khorramkoh) | 2009-07-14T18:04:07.000Z |
⤷Today(OneRepublic album) | 2009-07-13T16:25:47.000Z |
⤷Phosphorus(III) oxide | 2009-07-13T14:40:09.000Z |
⤷Marko Popović(footballer) | 2009-07-13T13:03:48.000Z |
⤷Almost Honest(Megadeth song) | 2009-07-13T11:58:13.000Z |
⤷Benzo(c)pyridine | 2009-07-12T18:08:49.000Z |
⤷Jack Taylor(TV Financial News Anchor) | 2009-07-10T18:05:41.000Z |
⤷Cat Cay(s) | 2009-07-10T14:48:04.000Z |
⤷Strontium(II) bromide | 2009-07-10T10:11:23.000Z |
⤷Strontium(II) iodide | 2009-07-10T10:11:02.000Z |
⤷Ferguson Lake(Nova Scotia) | 2009-07-09T13:02:35.000Z |
⤷Belle Lake(Nova Scotia) | 2009-07-09T12:42:33.000Z |
⤷Skeletons in the Closet(Children of Bodom album) | 2009-07-09T11:29:15.000Z |
Copper(II) phosphate | 2009-07-09T03:59:09.000Z |
⤷Vaana(Tamil film) | 2009-07-08T23:25:42.000Z |
⤷(+)-(R)-limonene | 2009-07-08T23:18:41.000Z |
⤷(+)-(4R)-limonene | 2009-07-08T23:16:03.000Z |
⤷(-)-(4S)-limonene | 2009-07-08T23:14:05.000Z |
⤷Claro River(Tinguirica) | 2009-07-08T02:03:42.000Z |
⤷1,3-bis(2-chloroethyl)-1-nitrosourea | 2009-07-07T22:32:11.000Z |
⤷1,25-(OH)2D3 | 2009-07-07T22:26:32.000Z |
⤷EMD GP40-2L(W) | 2009-07-07T19:32:52.000Z |
⤷Piney River(Thornton River) | 2009-07-07T02:52:07.000Z |
⤷Sakura(cigarette) | 2009-07-06T23:15:50.000Z |
⤷Karounga Keita(footballer) | 2009-07-06T05:10:43.000Z |
⤷Kira-Kira(Game) | 2009-07-06T03:44:12.000Z |
Bis(triphenylphosphine)palladium chloride | 2009-07-05T14:46:29.000Z |
⤷Jesse(given name) | 2009-07-05T09:22:02.000Z |
⤷George Law-(financier) | 2009-07-04T18:43:35.000Z |
⤷Catch 22(album) | 2009-07-04T17:28:26.000Z |
⤷Tucapel(commune) | 2009-07-04T09:14:24.000Z |
⤷SRC(B) | 2009-07-04T07:17:02.000Z |
⤷West Farms Square–(IRT White Plains Road Line) | 2009-07-03T14:31:19.000Z |
⤷Casuaniformes(Casuariiformes) | 2009-07-03T08:08:20.000Z |
⤷Parappurath(K.E.Mathai) | 2009-07-03T06:15:04.000Z |
⤷Fire(single) | 2009-07-02T22:08:51.000Z |
⤷Cerite-(Ce) | 2009-07-02T17:41:38.000Z |
⤷Cerite-(La) | 2009-07-02T17:41:27.000Z |
⤷The Liverbirds(band) | 2009-07-02T02:21:37.000Z |
⤷Trichloro(nitro)methane | 2009-07-01T15:35:05.000Z |
⤷CH3(CH2)15OH | 2009-07-01T10:17:17.000Z |
⤷Count To Free(single) | 2009-06-30T20:59:17.000Z |
⤷OASA(ALT) | 2009-06-30T20:13:58.000Z |
⤷ASA(ALT) | 2009-06-30T20:13:18.000Z |
⤷Collagen alpha-1(IV) chain | 2009-06-30T19:58:34.000Z |
⤷Alcazar(band) | 2009-06-30T13:01:38.000Z |
⤷NH2(CH2)5NH2 | 2009-06-30T12:47:59.000Z |
⤷CH(CH3)3 | 2009-06-30T10:42:47.000Z |
⤷Chloro-(chloromethoxy)methane | 2009-06-29T20:30:08.000Z |
⤷3a-Hydroxymethyl-1-isopropenyl-5a,5b,8,8,11a-pentamethyl-icosahydro-cyclopenta(a)chrysen-9-ol | 2009-06-29T20:10:14.000Z |
⤷C6H2(OH)(CH3)(C(CH3)3)2 | 2009-06-29T20:05:41.000Z |
⤷C6H5CHCHC(O)CH3 | 2009-06-29T19:56:13.000Z |
⤷C6H5CH2N(CH3)2 | 2009-06-29T19:48:24.000Z |
⤷Rob Shaw(film) | 2009-06-29T19:17:35.000Z |
⤷HO2CCH(NH2)CH2CO2H | 2009-06-29T16:20:15.000Z |
⤷S2(CH2)2CHCO2H | 2009-06-29T16:16:45.000Z |
⤷C6H4(NH2)COOH | 2009-06-29T15:56:47.000Z |
⤷CH3(CH2)4ONO2 | 2009-06-29T15:41:35.000Z |
⤷CH3CH(NH2)COOH | 2009-06-29T14:56:28.000Z |
⤷(CH2)4(CN)2 | 2009-06-29T14:48:08.000Z |
⤷(CH2)4(CO2H)2 | 2009-06-29T14:47:36.000Z |
⤷Bhavanisagar (SC)(State Assembly Constituency) | 2009-06-29T12:48:57.000Z |
⤷Jayamkondam(State Assembly Constituency) | 2009-06-29T12:43:12.000Z |
⤷All Roads Lead to You(single) | 2009-06-29T11:48:01.000Z |
⤷C6H5NH(COCH3) | 2009-06-29T09:44:37.000Z |
Poly(dichlorophosphazene) | 2009-06-28T22:01:49.000Z |
⤷Total World Domination(album) | 2009-06-28T21:59:24.000Z |
⤷NH4(Cr(ScN)4(NH3)2) | 2009-06-28T16:46:19.000Z |
⤷Zr(OH)4 | 2009-06-28T16:38:05.000Z |
⤷Zn(CN)2 | 2009-06-28T16:34:02.000Z |
⤷Xe(PtF6) | 2009-06-28T16:16:47.000Z |
⤷UO2(NO3)2 | 2009-06-28T16:07:53.000Z |
⤷(Cu(NH3)4)SO4 | 2009-06-28T15:55:59.000Z |
⤷Na4Fe(CN)6 | 2009-06-28T15:23:50.000Z |
⤷(SiOx(OH)4-2x)n | 2009-06-28T15:20:55.000Z |
⤷Sc(NO3)3 | 2009-06-28T15:16:56.000Z |
⤷Sc(OSO2CF3)3 | 2009-06-28T15:15:19.000Z |
⤷Fe4(Fe(CN)6)3 | 2009-06-28T15:11:04.000Z |
⤷K3(Fe(C2O4)3) | 2009-06-28T15:07:13.000Z |
⤷K2SO4.Al2(SO4)3·24H2O | 2009-06-28T15:05:05.000Z |
⤷Phosphoric(III) acid | 2009-06-28T14:56:51.000Z |
⤷Pd(NO3)2 | 2009-06-28T14:48:56.000Z |
⤷K2(HgI4) | 2009-06-28T14:43:53.000Z |
⤷Hg(ONC)2 | 2009-06-28T14:34:03.000Z |
⤷Pb(SO4) | 2009-06-28T14:25:16.000Z |
⤷Pb(CO3) | 2009-06-28T14:23:14.000Z |
⤷La2(CO3)3 | 2009-06-28T14:22:29.000Z |
⤷Fe(NO3)3(H2O)9 | 2009-06-28T14:20:49.000Z |
⤷FSO2(OH) | 2009-06-28T14:02:42.000Z |
⤷C3cl3K2SO4Cr2(SO4)3.24H2O | 2009-06-28T13:54:47.000Z |
⤷Cis-platinum(II) chloride diammine | 2009-06-28T13:49:53.000Z |
⤷PtCl2(NH3)2 | 2009-06-28T13:48:51.000Z |
⤷Cd(NO3)2 | 2009-06-28T13:35:21.000Z |
⤷(NH4)2Ce(NO3)6 | 2009-06-28T12:49:02.000Z |
⤷Al(NO3)3 | 2009-06-28T12:46:56.000Z |
⤷Dharapuram (SC)(State Assembly Constituency) | 2009-06-28T00:08:57.000Z |
⤷Sanjay Gupta(Raj Comics) | 2009-06-26T14:09:04.000Z |
⤷HMS Princess(1905) | 2009-06-24T21:58:01.000Z |
⤷Zr(WO4)2 | 2009-06-24T17:00:35.000Z |
⤷Papanasam(Tirunelveli) | 2009-06-24T14:59:45.000Z |
⤷Mya And Friends Presents...Best Of Both Worlds(Mýa album) | 2009-06-23T12:29:31.000Z |
⤷Rajendranagar(Assembly constituency) | 2009-06-22T22:42:19.000Z |
⤷Treaty of Amiens(1423) | 2009-06-21T14:46:01.000Z |
⤷Graniteville(Waterford) | 2009-06-21T13:56:24.000Z |
⤷Sr(NO3)2 | 2009-06-21T11:39:01.000Z |
⤷Wang Qiang(Fighter) | 2009-06-21T04:36:41.000Z |
⤷Yongkang City(China) | 2009-06-19T14:03:41.000Z |
⤷S(q) | 2009-06-18T07:59:28.000Z |
⤷(RhCl(cod))2 | 2009-06-18T05:55:38.000Z |
⤷Fe2(CO)9 | 2009-06-18T02:16:32.000Z |
⤷Hg(SCN)2 | 2009-06-17T23:20:45.000Z |
⤷Operation Creature Feature(video game) | 2009-06-17T23:12:32.000Z |
⤷Digger(PlayStation 3) | 2009-06-17T23:04:16.000Z |
⤷USS LSM(R)-524 | 2009-06-17T14:08:44.000Z |
⤷1-(3-Chlorophenyl)piperazine | 2009-06-15T22:59:46.000Z |
⤷Shi'a view of ali ameer ul momeneen(as) | 2009-06-15T12:55:14.000Z |
⤷Shi'a view of al mahdi(as) | 2009-06-15T12:50:50.000Z |
⤷Karanji kannada Movie(2009) | 2009-06-15T09:44:35.000Z |
⤷Askania-Nova(settlement) | 2009-06-13T17:56:51.000Z |
⤷Osmium(IV) oxide | 2009-06-13T09:46:07.000Z |
⤷Carlos Reyes(Uruguay) | 2009-06-12T14:11:37.000Z |
⤷Pd(dba)2 | 2009-06-12T05:26:38.000Z |
⤷Smash Cars(PlayStation 3) | 2009-06-11T17:48:17.000Z |
⤷Prod() | 2009-06-11T13:50:30.000Z |
⤷Sum() | 2009-06-11T13:36:33.000Z |
⤷Passenger(2009 film) | 2009-06-09T22:47:38.000Z |
⤷2nd Asian Para Games(2014 Asian Para Games) | 2009-06-07T13:29:16.000Z |
⤷1st Asian Para Games(2010 Asian Para Games) | 2009-06-07T09:35:24.000Z |
⤷Frank Phillips(golfer) | 2009-06-07T09:09:05.000Z |
⤷FFG(X) | 2009-06-07T05:45:30.000Z |
⤷Piggy D.(guitarist) | 2009-06-06T16:36:55.000Z |
⤷The Pope Must Die(t) | 2009-06-06T01:45:32.000Z |
⤷RAF Volunteer Reserve(Training) | 2009-06-05T18:00:07.000Z |
⤷Fortis holding(finance) | 2009-06-05T16:04:24.000Z |
⤷Dancing Under Streetlights(The Brains album) | 2009-06-05T03:21:57.000Z |
Europium(III) oxide | 2009-06-04T03:18:10.000Z |
⤷Nocturnes(Chopin) | 2009-06-04T02:13:44.000Z |
⤷Jamal Malik(Slumdog Millionaire Character) | 2009-06-04T02:00:23.000Z |
⤷Bismuth(V) fluoride | 2009-06-04T01:15:58.000Z |
⤷Savadi(ron) | 2009-06-03T23:33:50.000Z |
⤷Ahmed Yusuf(Gobroon) | 2009-06-03T14:57:34.000Z |
⤷青(single) | 2009-06-03T00:15:06.000Z |
⤷Litti(cuisine) | 2009-06-02T23:39:09.000Z |
⤷Six Suspects(novel) | 2009-06-02T18:49:29.000Z |
⤷Suiren(song) | 2009-05-31T21:58:49.000Z |
⤷Brown's Requiem(novel) | 2009-05-31T11:45:05.000Z |
⤷Dr. Emilio B. Espinosa Sr. Memorial State College of Agriculture and Technology(DEBESMSCAT) | 2009-05-31T07:46:16.000Z |
Aluminium(I) oxide | 2009-05-31T07:23:44.000Z |
Aluminium(II) oxide | 2009-05-31T06:37:23.000Z |
⤷Shinji Takahashi(baseball) | 2009-05-31T01:29:18.000Z |
⤷If It Ain't One Thing, It's Another(Richard "Dimples" Fields song) | 2009-05-30T22:48:31.000Z |
⤷Shoeshine Boy(song) | 2009-05-30T22:25:24.000Z |
⤷Ujjain Public School(UPS) | 2009-05-30T08:27:50.000Z |
⤷Flagman(Game & Watch) | 2009-05-30T02:51:45.000Z |
⤷Institut Pendidikan Guru Malaysia, Kampus Kota Bharu(IPGM Kampus KB) | 2009-05-29T11:57:07.000Z |
⤷Pb(OH)2 | 2009-05-29T01:35:16.000Z |
⤷Luz y Sombra(album) | 2009-05-29T01:05:04.000Z |
⤷N(G)-monomethyl-L-arginine | 2009-05-28T20:09:42.000Z |
⤷Puthalapattu (SC)(Assembly constituency) | 2009-05-28T15:31:32.000Z |
⤷Quthbullapur(Assembly constituency) | 2009-05-28T15:31:21.000Z |
⤷Palamaner(Assembly constituency) | 2009-05-28T15:31:09.000Z |
⤷Kuppam(Assembly constituency) | 2009-05-28T15:23:41.000Z |
⤷Indian Institute of Space Science and Technology, Ponmudi(Trivandrum) | 2009-05-27T16:22:36.000Z |
⤷Ep(mono band) | 2009-05-27T10:44:38.000Z |
⤷Mono band(album) | 2009-05-27T10:09:14.000Z |
⤷Poly(2,6-dimethylphenylene oxide) | 2009-05-27T07:09:52.000Z |
⤷1,2-bis(dimethylphosphino)ethane | 2009-05-26T23:37:10.000Z |
⤷Corporate 2(film) | 2009-05-26T22:15:37.000Z |
Nitrosonium octafluoroxenate(VI) | 2009-05-26T17:39:21.000Z |
⤷HCO(3)(-) | 2009-05-25T19:16:23.000Z |
⤷Behind the Garden - Behind the Wall - Under the Tree(album) | 2009-05-25T14:35:27.000Z |
⤷Vila(Emina Jahovic album) | 2009-05-25T07:37:29.000Z |
⤷Cis-diamminedichloroplatinum(II) | 2009-05-24T22:32:01.000Z |
⤷1,25(OH)2D3 | 2009-05-24T22:03:19.000Z |
⤷Bhatti(Rajpoot) | 2009-05-24T10:12:59.000Z |
⤷Chittoor(Assembly constituency) | 2009-05-24T04:48:06.000Z |
⤷Waverly Hills 9-0-2-1-(Annoyed Grunt) | 2009-05-24T02:15:02.000Z |
⤷K(+) | 2009-05-23T23:11:56.000Z |
⤷Na(+) | 2009-05-23T23:11:20.000Z |
⤷Ca(2+) | 2009-05-23T23:09:41.000Z |
⤷Prostaglandin E(2) | 2009-05-23T22:56:48.000Z |
⤷JSDLP(PZ) | 2009-05-22T22:25:45.000Z |
⤷JCP(PZ) | 2009-05-22T19:37:32.000Z |
⤷Apartment(film) | 2009-05-22T11:25:10.000Z |
⤷Coin(department store) | 2009-05-21T20:25:28.000Z |
⤷N(G)-nitro-L-arginine | 2009-05-21T17:35:39.000Z |
⤷Jeong Myeong(-)hun | 2009-05-21T14:14:47.000Z |
⤷Poly(ADP-ribose) polymerase-1 | 2009-05-21T06:14:27.000Z |
⤷Fantastic Voyage(Lakeside song) | 2009-05-21T03:42:15.000Z |
⤷Give Me The Night(George Benson song) | 2009-05-21T00:38:26.000Z |
⤷I.Q(series) | 2009-05-20T21:50:29.000Z |
⤷Special Lady(Ray, Goodman & Brown song) | 2009-05-20T21:12:55.000Z |
⤷William B. Turner(Medal of Honor) | 2009-05-20T17:25:10.000Z |
⤷Fast InvSqrt() | 2009-05-19T13:14:16.000Z |
L(a | 2009-05-18T22:36:54.000Z |
⤷Critter Crunch(PlayStation 3) | 2009-05-18T17:40:27.000Z |
⤷The Power(of Bhangra) | 2009-05-18T17:01:23.000Z |
⤷2009 influenza A(H1N1) outbreak | 2009-05-18T03:30:30.000Z |
⤷287(g) program | 2009-05-17T23:26:23.000Z |
⤷Shatter(video games) | 2009-05-17T02:57:29.000Z |
⤷Dear(Shion Miyawaki) | 2009-05-16T18:49:27.000Z |
⤷2009 A(H1N1) | 2009-05-16T15:02:31.000Z |
⤷Mind the gap(album) | 2009-05-16T11:13:49.000Z |
⤷Gábor Nagy(born in 1985) | 2009-05-16T09:33:29.000Z |
⤷The Art(e) Of Romance | 2009-05-16T02:02:12.000Z |
⤷Sport-Auto(french) | 2009-05-14T21:39:26.000Z |
⤷Panzerkampfwagen 35(t) | 2009-05-14T19:47:01.000Z |
⤷BOY(Shion Miyawaki) | 2009-05-14T08:47:50.000Z |
1,2-Bis(dimethylphosphino)ethane | 2009-05-12T20:42:07.000Z |
⤷Naheere(Syriac Orhtodox) | 2009-05-12T08:54:55.000Z |
⤷Sandakoli(2005 film) | 2009-05-11T09:59:30.000Z |
⤷Diethylenetriamine penta(methylene phosphonic acid) | 2009-05-11T07:18:43.000Z |
⤷Ethylenediamine tetra(methylene phosphonic acid) | 2009-05-11T07:02:37.000Z |
⤷Songs of Life(1992 album) | 2009-05-11T02:57:08.000Z |
⤷Rasta Got Soul(album) | 2009-05-09T16:15:41.000Z |
⤷(benzene)-chromium(0) tricarbonyl | 2009-05-07T22:24:12.000Z |
⤷2009 Influenza A(H1N1) Outbreak | 2009-05-07T20:55:59.000Z |
⤷Dichlorobis(ethylenediamine)cobalt (III) chloride | 2009-05-07T01:39:19.000Z |
⤷2009 Influenza A(H1N1) outbreak | 2009-05-06T20:44:51.000Z |
Tetrakis(acetonitrile)copper(I) hexafluorophosphate | 2009-05-06T17:17:29.000Z |
⤷Scandium(III) triflate | 2009-05-06T12:16:54.000Z |
⤷National Institute of Bank Management(NIBM) | 2009-05-06T09:49:46.000Z |
⤷Special Service(The Twilight Zone) | 2009-05-06T00:25:19.000Z |
⤷Rahue River(Bío-Bío) | 2009-05-05T21:32:55.000Z |
Cis-Dichlorobis(ethylenediamine)cobalt(III) chloride | 2009-05-05T20:24:11.000Z |
⤷Tangerine Dream(album) | 2009-05-05T02:09:37.000Z |
⤷John Egan(Hurler) | 2009-05-03T03:17:59.000Z |
⤷CpCo(CO)2 | 2009-05-03T03:15:51.000Z |
⤷Chinese language(s) | 2009-05-02T11:12:28.000Z |
⤷CpRu(PPh3)2Cl | 2009-05-01T17:22:33.000Z |
⤷Niobium(IV) Chloride | 2009-05-01T15:55:15.000Z |
⤷Swine-Origin Influenza A(H1N1) | 2009-05-01T13:00:31.000Z |
⤷Swine-origin influenza A(H1N1) | 2009-05-01T12:59:21.000Z |
⤷Turn Right(Jonas Brothers song) | 2009-05-01T09:30:58.000Z |
⤷Hey Baby(Jonas Brothers song) | 2009-05-01T09:27:38.000Z |
Niobium(IV) chloride | 2009-05-01T03:45:27.000Z |
Manganese(II) acetate | 2009-05-01T01:31:53.000Z |
⤷Rhodium(II) oxide | 2009-05-01T00:33:17.000Z |
⤷Paul child(actor) | 2009-05-01T00:10:02.000Z |
⤷Ayna(Group) | 2009-04-30T23:56:12.000Z |
Cobalt(II) cyanide | 2009-04-30T23:16:18.000Z |
⤷Influenza A(H1N1) | 2009-04-30T19:05:25.000Z |
⤷List of Speakers of the Shura Council(Egypt) | 2009-04-30T15:40:12.000Z |
⤷Keith Anderson(Australian politician) | 2009-04-30T14:43:03.000Z |
Rhodium(IV) oxide | 2009-04-30T07:45:54.000Z |
Chloro(cyclopentadienyl)bis(triphenylphosphine)ruthenium | 2009-04-30T02:29:51.000Z |
⤷A(H1N1) | 2009-04-30T00:01:11.000Z |
⤷Speed racer(movie) | 2009-04-29T10:40:15.000Z |
⤷Machakhlistskal(i) | 2009-04-27T14:43:07.000Z |
⤷CAUSA(Compania Aeronáutica Uruguaya S.A.) | 2009-04-27T10:37:25.000Z |
⤷NAD(P)H dehydrogenase | 2009-04-27T10:10:29.000Z |
⤷Army Aviation Corps(India) | 2009-04-26T16:32:12.000Z |
⤷Falling In Love(McFly Song) | 2009-04-26T00:02:51.000Z |
⤷Ca3(P04)2 | 2009-04-25T20:04:28.000Z |
⤷Uttara Foods and Feeds(company) | 2009-04-25T18:20:05.000Z |
⤷Tom Cronin(hurler) | 2009-04-24T20:42:16.000Z |
⤷Prof(Dr)P. K. Pokker | 2009-04-23T12:32:05.000Z |
⤷Dr.H.Srinivasan M.B.B.S., F.R.C.S (Lond)., F.R.C.S.(Eng). | 2009-04-22T23:52:55.000Z |
⤷Mocoví(tribe) | 2009-04-22T17:43:44.000Z |
⤷Cranberry Lake,(Nova Scotia) | 2009-04-22T12:50:25.000Z |
1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide | 2009-04-22T01:41:18.000Z |
⤷SS John B. Cowle(1902) | 2009-04-21T19:21:22.000Z |
⤷National Highway 21A (India)(old numbering) | 2009-04-21T13:45:00.000Z |
⤷National Highway 54A (India)(old numbering) | 2009-04-20T18:06:59.000Z |
⤷Friends(Season 1) | 2009-04-20T13:22:07.000Z |
⤷Mydukur(Assembly constituency) | 2009-04-20T09:51:23.000Z |
⤷Riot!(album) | 2009-04-20T02:24:11.000Z |
⤷All We Know Is Falling(album) | 2009-04-20T02:18:16.000Z |
⤷2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromenylium | 2009-04-19T10:45:48.000Z |
⤷National Highway 214A (India)(old numbering) | 2009-04-18T19:25:31.000Z |
⤷4-(p-methylphenyl)-4-oxobutanoic acid | 2009-04-18T02:33:19.000Z |
⤷4-(4-Methylphenyl)-4-oxobutyric acid | 2009-04-18T01:22:24.000Z |
⤷3-(p-Toluoyl)propionic acid | 2009-04-18T01:21:08.000Z |
⤷3-(4-Methylbenzoyl)propionic Acid | 2009-04-18T01:19:47.000Z |
⤷National Highway 71B (India)(old numbering) | 2009-04-17T20:03:41.000Z |
⤷National Highway 71A (India)(old numbering) | 2009-04-17T20:01:54.000Z |
⤷Dr.No(FILM) | 2009-04-17T18:57:06.000Z |
⤷Andhra Pradesh(state assembly elections) | 2009-04-17T17:50:21.000Z |
⤷National Highway 25A (India)(Old Numbering) | 2009-04-17T16:26:27.000Z |
4-(4-Methylphenyl)-4-oxobutanoic acid | 2009-04-17T15:24:08.000Z |
⤷National Highway 17B (India)(old numbering) | 2009-04-17T13:46:27.000Z |
⤷National Highway 17A (India)(old Numbering) | 2009-04-17T13:46:19.000Z |
⤷National Highway 8E (India)(old numbering) | 2009-04-17T13:34:29.000Z |
⤷National Highway 8D (India)(old numbering) | 2009-04-17T13:34:21.000Z |
⤷Ahmednagar City(Maharashtra Assembly constituency) | 2009-04-17T09:54:29.000Z |
⤷Dear...(Tenjochiki's Album) | 2009-04-15T16:01:30.000Z |
⤷National Highway 8C (India)(Old Numbering) | 2009-04-15T13:09:54.000Z |
⤷National Highway 8A (India)(old numbering) | 2009-04-15T12:38:56.000Z |
⤷The Family(Omega Man) | 2009-04-15T00:24:32.000Z |
⤷Allison McKenzie(Actress) | 2009-04-14T03:33:31.000Z |
⤷Art. 100(b) EPC | 2009-04-13T07:46:54.000Z |
⤷Article 100(b) EPC | 2009-04-13T07:46:01.000Z |
⤷Lioness EP(Lioness album) | 2009-04-13T01:23:41.000Z |
⤷Mazda RX-7 Type RS/FD Type 5/6(FD3S) | 2009-04-12T11:36:23.000Z |
⤷3-chloro-6-(2-diethylamino-ethoxy)-10-(2-diethylamino-ethyl)-acridone | 2009-04-12T04:12:03.000Z |
⤷Swami(marathi novel) | 2009-04-11T16:10:30.000Z |
⤷Dr.H.Srinivasan M.B.Bs., F.R.C.S (Lond)., F.R.C.S.(Eng). | 2009-04-10T05:33:39.000Z |
⤷EPCP(M-L) | 2009-04-09T16:40:59.000Z |
⤷David Kirke(DSC) | 2009-04-09T14:08:16.000Z |
⤷3-Chloro-6-(2-diethylamino-ethoxy)-10-(2-diethylamino-ethyl)-acridone | 2009-04-09T06:22:59.000Z |
⤷Saw(Game) | 2009-04-08T22:05:26.000Z |
⤷Mascara(CSI: Episode) | 2009-04-08T21:31:30.000Z |
⤷T(11;14) | 2009-04-08T16:25:40.000Z |
T(11:14) | 2009-04-08T16:25:26.000Z |
⤷T(9;22) | 2009-04-08T16:23:54.000Z |
⤷Musudan(Missile) | 2009-04-07T04:44:43.000Z |
⤷Alan Johnson(baseball) | 2009-04-07T02:05:28.000Z |
⤷Frontière(s) | 2009-04-06T21:44:19.000Z |
⤷Frontiere(s) | 2009-04-06T21:43:40.000Z |
⤷Ayya-2005(kannada) | 2009-04-05T16:00:07.000Z |
⤷C6H4(OH)COOH | 2009-04-05T11:39:33.000Z |
⤷Silver(I) selenite | 2009-04-05T01:23:25.000Z |
⤷Melrose(TV Series) | 2009-04-04T19:48:27.000Z |
⤷Reg District(Helmand) | 2009-04-04T15:57:25.000Z |
Niobium(V) bromide | 2009-04-04T02:38:18.000Z |
⤷Grzywna(money) | 2009-04-02T20:54:42.000Z |
⤷(-)-2β-(3-(4-methylphenyl)isoxazol-5-yl)-3β-(4-chlorophenyl)tropane | 2009-04-02T12:48:58.000Z |
⤷(-)-2β-(1,2,4-oxadiazol-5-methyl)-3β-phenyltropane | 2009-04-02T12:48:20.000Z |
⤷Mathadhaana(film) | 2009-04-02T08:36:34.000Z |
⤷Lieutenant General Hamid Nawaz Khan, HI(M) | 2009-04-02T06:59:41.000Z |
⤷Kevin Burns(Mayor) | 2009-04-02T01:23:15.000Z |
⤷Team Vodafone(V8 Supercars) | 2009-04-01T22:50:39.000Z |
⤷Mary Crawford(Mansfield Park) | 2009-04-01T22:13:41.000Z |
⤷Get the Picture(1965 album) | 2009-04-01T03:44:10.000Z |
⤷Perumthachan(Film) | 2009-03-31T23:08:39.000Z |
⤷Tungi(Biharsharif) | 2009-03-31T14:40:15.000Z |
⤷Jeghatoo(Waeez Shahid) District | 2009-03-31T12:17:21.000Z |
⤷Murtaugh(How I Met Your Mother) | 2009-03-31T02:06:06.000Z |
⤷Rajapura(Kamboja) | 2009-03-29T20:12:43.000Z |
⤷Canyon(Novel) | 2009-03-28T20:59:55.000Z |
⤷Co(OH)2 | 2009-03-28T04:04:56.000Z |
Cobalt(II) hydroxide | 2009-03-28T03:13:38.000Z |
⤷Liverpool Cult Classics Unearthed - Volume Two(CD) | 2009-03-27T18:23:07.000Z |
⤷Touchstone(band) | 2009-03-27T17:00:17.000Z |
⤷National Highway 37A (India)(old numbering) | 2009-03-26T17:39:58.000Z |
⤷Phenomenon(song) | 2009-03-26T03:03:00.000Z |
⤷Iron(III) sulphate | 2009-03-25T22:13:44.000Z |
⤷Greatest Hits, Vol. 2(Kenny Chesney album) | 2009-03-25T20:57:17.000Z |
⤷National Highway 5A (India)(Old Numbering) | 2009-03-24T18:27:19.000Z |
⤷MahaRaja's Boys' High School(M.R.B.H. School) | 2009-03-23T21:45:26.000Z |
⤷National Highway 4A (India)(Old Numbering) | 2009-03-23T19:02:31.000Z |
⤷National Highway 4B (India)(Old Numbering) | 2009-03-23T18:44:43.000Z |
⤷Thermal energy(conductivity) analyzer/detector | 2009-03-23T16:27:50.000Z |
⤷Many, Many Monkeys(The Twilight Zone) | 2009-03-22T22:27:08.000Z |
⤷5(FIVE) | 2009-03-22T07:48:52.000Z |
⤷KP(b)LiB | 2009-03-21T16:42:00.000Z |
⤷Y(4140) particle | 2009-03-21T14:33:16.000Z |
Y(4140) | 2009-03-21T01:35:41.000Z |
⤷Hurricane One(1851) | 2009-03-21T01:20:31.000Z |
⤷Na(OH) | 2009-03-20T20:40:22.000Z |
⤷National Highway 228 (India)(old numbering) | 2009-03-20T12:53:44.000Z |
⤷National Highway 218 (India)(old numbering) | 2009-03-20T12:52:52.000Z |
⤷National Highway 216 (India)(old numbering) | 2009-03-20T12:52:37.000Z |
⤷National Highway 214 (India)(old numbering) | 2009-03-20T12:52:23.000Z |
⤷National Highway 207 (India)(Old Numbering) | 2009-03-20T12:52:11.000Z |
⤷National Highway 152 (India)(Old Numbering) | 2009-03-20T12:51:32.000Z |
⤷National Highway 125 (India)(Old Numbering) | 2009-03-20T12:46:06.000Z |
⤷National Highway 123 (India)(old numbering) | 2009-03-20T12:45:41.000Z |
⤷National Highway 121 (India)(old numbering) | 2009-03-20T12:45:18.000Z |
⤷National Highway 119 (India)(Old Numbering) | 2009-03-20T12:44:48.000Z |
⤷National Highway 113 (India)(old numbering) | 2009-03-20T12:43:46.000Z |
⤷National Highway 109 (India)(old numbering) | 2009-03-20T12:43:00.000Z |
⤷National Highway 104 (India)(Old Numbering) | 2009-03-20T12:41:59.000Z |
⤷National Highway 101 (India)(Old Numbering) | 2009-03-20T12:41:24.000Z |
⤷National Highway 92 (India)(old numbering) | 2009-03-20T12:40:35.000Z |
⤷National Highway 88 (India)(old numbering) | 2009-03-20T12:39:50.000Z |
⤷National Highway 85 (India)(old numbering) | 2009-03-20T12:39:37.000Z |
⤷National Highway 84 (India)(Old Numbering) | 2009-03-20T12:39:25.000Z |
⤷National Highway 79 (India)(old numbering) | 2009-03-20T12:39:09.000Z |
⤷National Highway 78 (India)(old numbering) | 2009-03-20T12:38:57.000Z |
⤷National Highway 73 (India)(old numbering) | 2009-03-20T12:38:39.000Z |
⤷National Highway 65 (India)(old numbering) | 2009-03-20T12:37:54.000Z |
⤷National Highway 64 (India)(old numbering) | 2009-03-20T12:37:39.000Z |
⤷National Highway 54 (India)(old numbering) | 2009-03-20T12:37:01.000Z |
⤷National Highway 52 (India)(old numbering) | 2009-03-20T12:36:46.000Z |
⤷National Highway 51 (India)(old numbering) | 2009-03-20T12:36:19.000Z |
⤷CFEL-FM(1) | 2009-03-20T03:01:56.000Z |
⤷Black(Black album) | 2009-03-20T02:39:15.000Z |
⤷VMF(N)-543 | 2009-03-20T01:28:31.000Z |
⤷VF2004(1) | 2009-03-19T23:28:38.000Z |
⤷CPI(ML) New Initiative | 2009-03-19T15:35:29.000Z |
⤷CPI(ML) ND | 2009-03-19T15:33:56.000Z |
Praseodymium(III) oxide | 2009-03-19T02:05:16.000Z |
⤷Imagination(album) | 2009-03-19T01:05:24.000Z |
Neptunium(IV) oxide | 2009-03-19T01:02:51.000Z |
⤷Transition(R) | 2009-03-18T23:34:12.000Z |
⤷Transition(R) Roadable Aircraft Proof of Concept | 2009-03-18T23:16:25.000Z |
⤷National Highway 150 (India)(old numbering) | 2009-03-18T10:16:01.000Z |
Neodymium(III) oxide | 2009-03-18T06:06:35.000Z |
⤷CKPT-FM(1) | 2009-03-18T04:55:38.000Z |
⤷Benzenamine, 3-(trifluoromethyl)- | 2009-03-17T13:35:09.000Z |
⤷ChinaCache(CDN) | 2009-03-17T00:25:29.000Z |
⤷PC(R) | 2009-03-16T21:10:05.000Z |
⤷FEC(m-l) | 2009-03-16T21:05:41.000Z |
⤷Tracy Strauss(Character) | 2009-03-16T20:45:17.000Z |
⤷CP(BSTI) | 2009-03-16T20:34:47.000Z |
⤷Harry Freedman(author) | 2009-03-16T19:28:52.000Z |
⤷Sehnsucht(Lacrimosa Album) | 2009-03-16T04:34:07.000Z |
⤷CPI(ML) 2nd CC | 2009-03-15T17:21:49.000Z |
⤷H(x) | 2009-03-15T12:31:13.000Z |
⤷G(x) | 2009-03-15T12:30:56.000Z |
⤷Φ(n) | 2009-03-15T12:30:16.000Z |
⤷Wish You Were Here(Grey's Anatomy) | 2009-03-14T23:27:27.000Z |
⤷501(c)3 status | 2009-03-14T07:19:59.000Z |
⤷National Highway 75 (India)(old numbering) | 2009-03-12T12:51:17.000Z |
⤷National Highway 155 (India)(Old Numbering) | 2009-03-12T11:53:24.000Z |
⤷JSD(Rab) | 2009-03-12T09:54:28.000Z |
⤷National Highway 98 (India)(old numbering) | 2009-03-12T02:15:24.000Z |
⤷CPN(UC-M) | 2009-03-11T17:50:35.000Z |
⤷CPB(M-L) | 2009-03-11T17:45:51.000Z |
⤷OCR(m-l) | 2009-03-11T16:15:24.000Z |
⤷National Highway 39 (India)(old numbering) | 2009-03-11T11:58:29.000Z |
Potassium hexanitritocobaltate(III) | 2009-03-10T23:38:12.000Z |
⤷Cobalt(II) sulfide | 2009-03-10T22:43:42.000Z |
PCP(M-L) | 2009-03-10T19:56:48.000Z |
⤷Chromium(III) potassium sulfate | 2009-03-10T15:37:08.000Z |
⤷N(6)-carboxymethyllysine | 2009-03-10T12:27:03.000Z |
⤷Reach(ESTK song) | 2009-03-10T03:51:33.000Z |
⤷Symmetric Key Management(Key Derivation and Key Wrap) | 2009-03-10T03:29:12.000Z |
⤷National Highway 44 (India)(old numbering) | 2009-03-09T19:19:30.000Z |
Fasc(UK) | 2009-03-09T15:25:23.000Z |
⤷TI(M) | 2009-03-09T14:45:29.000Z |
⤷SI(M) | 2009-03-09T14:20:14.000Z |
⤷Ni(NO3)2 | 2009-03-09T09:55:38.000Z |
⤷Pete Williams(television correspondent) | 2009-03-09T06:35:21.000Z |
⤷Hotel for Dogs(film) | 2009-03-08T22:17:30.000Z |
⤷Mp41(r) | 2009-03-08T18:18:31.000Z |
⤷Tweaking(drug slang) | 2009-03-08T09:05:00.000Z |
Potassium tetraperoxochromate(V) | 2009-03-07T22:56:07.000Z |
⤷Carlos Johnson(soccer) | 2009-03-06T07:49:01.000Z |
⤷Kallar(caste) | 2009-03-06T03:09:39.000Z |
Beautiful Me(s): Finding Our Revolutionary Selves | 2009-03-06T00:30:59.000Z |
⤷No You Girls(song) | 2009-03-05T18:25:08.000Z |
⤷Otto Kerner Jr.(version 2) | 2009-03-05T02:24:11.000Z |
⤷Hangfire(firearms) | 2009-03-05T00:35:30.000Z |
⤷Dive Bomber(film) | 2009-03-04T06:17:24.000Z |
⤷Y=sin(1/x) | 2009-03-04T04:07:36.000Z |
⤷National Waterway III(India) | 2009-03-04T03:28:28.000Z |
⤷CJLX-FM(2) | 2009-03-03T02:05:29.000Z |
⤷C(M)PA | 2009-03-03T00:28:33.000Z |
⤷Last Hero(2001) | 2009-03-02T19:30:37.000Z |
⤷PSA(CP) | 2009-03-02T18:02:44.000Z |
⤷Atmospherics(Bass Communion album) | 2009-03-02T16:12:25.000Z |
⤷Y = sin(1/x) | 2009-03-01T19:23:57.000Z |
⤷501(c)3 organization | 2009-03-01T14:32:39.000Z |
⤷Bristol Mountain(NY) | 2009-02-27T07:58:33.000Z |
Sexual Harassment Panda(character) | 2009-02-26T22:31:39.000Z |
⤷Sher Khan(Bengal) | 2009-02-26T21:00:36.000Z |
⤷2-(4-chlorphenoxy)-ethanol | 2009-02-26T19:27:41.000Z |
⤷Echoplex(Nine Inch Nails song) | 2009-02-26T19:06:46.000Z |
⤷Cobalt(III) hexammine chloride | 2009-02-26T16:24:26.000Z |
⤷Gandhar(city/kingdom) | 2009-02-26T14:15:35.000Z |
⤷PCE(r) | 2009-02-26T11:24:59.000Z |
⤷PCB(ML) | 2009-02-26T09:56:03.000Z |
⤷Gordon Smith(Psychic) | 2009-02-25T20:00:43.000Z |
⤷National Highway 36 (India)(old numbering) | 2009-02-25T18:20:41.000Z |
⤷Ruthenium(II) tris(bathophenanthroline disulfonate) | 2009-02-25T06:20:00.000Z |
⤷East End(Peak) | 2009-02-25T01:17:06.000Z |
⤷Kbhit() | 2009-02-24T21:31:40.000Z |
⤷Getche() | 2009-02-24T21:27:40.000Z |
⤷Getch() | 2009-02-24T21:25:25.000Z |
⤷National Highway 99 (India)(old numbering) | 2009-02-24T19:15:49.000Z |
⤷Tris(dibenzylideneacetone)dipalladium | 2009-02-24T15:47:59.000Z |
⤷Tetrakis(triphenylphosphine)platinum | 2009-02-24T15:46:23.000Z |
⤷Saor Ollscoil na hÉireann(Free University of Ireland) | 2009-02-24T07:41:54.000Z |
⤷Albright(-McCune)(-Sternberg) syndrome | 2009-02-24T03:33:12.000Z |
⤷EIK(ml) | 2009-02-23T22:14:23.000Z |
⤷National Highway 215 (India)(old numbering) | 2009-02-23T20:09:58.000Z |
⤷National Highway 224 (India)(old numbering) | 2009-02-23T19:53:58.000Z |
⤷National Highway 217 (India)(old numbering) | 2009-02-23T19:43:53.000Z |
⤷Manoel(football player) | 2009-02-23T05:02:45.000Z |
⤷Ancylite-(La) | 2009-02-23T03:51:04.000Z |
⤷Ancylite-(Ce) | 2009-02-23T03:50:50.000Z |
⤷A423(M) | 2009-02-22T23:25:42.000Z |
⤷A404(M) | 2009-02-22T22:45:17.000Z |
⤷SJP(R) | 2009-02-22T18:30:39.000Z |
⤷NTRTDP(LP) | 2009-02-22T17:41:56.000Z |
⤷LM(HP) | 2009-02-22T17:22:26.000Z |
⤷OBG(W) | 2009-02-22T07:16:59.000Z |
⤷National Highway 55 (India)(old numbering) | 2009-02-21T19:31:33.000Z |
⤷National Highway 41 (India)(Old Numbering) | 2009-02-21T18:18:04.000Z |
⤷National Highway 33 (India)(old numbering) | 2009-02-21T16:44:33.000Z |
⤷I Love You(Oriya film) | 2009-02-20T05:25:20.000Z |
⤷River Lake(Nova Scotia) | 2009-02-19T16:54:49.000Z |
⤷Javier Suárez(economist) | 2009-02-19T09:26:55.000Z |
⤷Cin.get() | 2009-02-18T21:31:50.000Z |
⤷Boli(steroid) | 2009-02-18T20:31:21.000Z |
⤷National Highway 32 (India)(old numbering) | 2009-02-18T11:40:20.000Z |
⤷Han Han(韓寒) | 2009-02-17T16:06:52.000Z |
⤷Spectacle Lake(Nova Scotia) | 2009-02-17T10:51:26.000Z |
⤷Chittaranjan high school(E/M) | 2009-02-17T08:00:42.000Z |
⤷Eden Log(film) | 2009-02-16T20:34:44.000Z |
⤷USD(I) | 2009-02-16T18:59:33.000Z |
⤷Dream Girl(2009 film) | 2009-02-16T15:46:29.000Z |
⤷National Highway 100 (India)(Old Numbering) | 2009-02-16T15:45:58.000Z |
ISAD(G) | 2009-02-16T13:58:23.000Z |
⤷Phenylmercury(II) acetate | 2009-02-15T23:45:50.000Z |
⤷Powerlight(album) | 2009-02-15T15:12:36.000Z |
⤷National Highway 203 (India)(old numbering) | 2009-02-14T13:17:40.000Z |
⤷Java.lang.Object.clone() | 2009-02-14T02:14:20.000Z |
⤷Sascha ...(ein aufrechter Deutscher) | 2009-02-13T20:36:56.000Z |
⤷Praga(czech automobile maker) | 2009-02-13T11:46:19.000Z |
⤷National Highway 35 (India)(old numbering) | 2009-02-11T23:28:52.000Z |
⤷National Highway 34 (India)(old numbering) | 2009-02-11T14:59:31.000Z |
⤷National Highway 200 (India)(Old Numbering) | 2009-02-11T08:39:43.000Z |
⤷National Highway 201 (India)(Old Numbering) | 2009-02-11T08:11:11.000Z |
⤷Tin(II) selenide | 2009-02-10T15:55:17.000Z |
⤷Bright Eyes(Bright Eyes) | 2009-02-10T14:33:03.000Z |
⤷Lead(II) telluride | 2009-02-10T13:29:46.000Z |
⤷Lead(II) selenide | 2009-02-10T13:14:35.000Z |
⤷Tungsten(VI) oxide | 2009-02-10T12:24:22.000Z |
⤷Microtubule(s) | 2009-02-10T01:30:56.000Z |
⤷Lysosome(s) | 2009-02-10T01:14:12.000Z |
⤷Radio:Active(DVD) | 2009-02-09T17:13:48.000Z |
⤷Nasiruddin Mahmud Shah(Bengal) | 2009-02-09T12:29:56.000Z |
⤷Titanium(IV) silicide | 2009-02-09T11:48:46.000Z |
⤷Tantalum(III) nitride | 2009-02-09T11:23:49.000Z |
⤷Vanadium(II) nitride | 2009-02-09T11:19:46.000Z |
⤷Molybdenum(VI) oxide | 2009-02-08T22:40:31.000Z |
⤷Manganese(VII) oxide | 2009-02-08T22:18:05.000Z |
⤷Indium(III) antimonide | 2009-02-08T15:35:58.000Z |
⤷Indium(III) phosphide | 2009-02-08T15:22:10.000Z |
⤷Indium(III) nitride | 2009-02-08T15:03:53.000Z |
⤷4-(2,4-dichlorophenoxy)butyric acid | 2009-02-07T22:51:43.000Z |
⤷Mercury(II) telluride | 2009-02-07T19:15:07.000Z |
⤷Mercury(II) selenide | 2009-02-07T19:04:49.000Z |
⤷Jeghatoo(Waeez shahid) District | 2009-02-07T17:00:58.000Z |
⤷CHMY-FM-1(1) | 2009-02-07T15:17:29.000Z |
⤷Titanium(II) hydride | 2009-02-06T19:13:38.000Z |
⤷1-(2-hydroxyethyl)-2-hydroxymethyl-5-nitroimidazole | 2009-02-05T20:48:17.000Z |
⤷Dichloro(1,5-cyclooctadiene)platinum(II) | 2009-02-04T05:35:11.000Z |
Dichloro(cycloocta-1,5-diene)platinum(II) | 2009-02-04T05:16:35.000Z |
⤷Myelodysplastic syndrome associated with isolated del(5q) chromosome abnormality | 2009-02-04T05:16:23.000Z |
⤷John Healy(Hurler) | 2009-02-03T21:16:18.000Z |
⤷Nakai(Japanese vocation) | 2009-02-03T20:01:37.000Z |
⤷3-phospho-(R)-glycerate | 2009-02-02T20:39:52.000Z |
⤷Tigran Martirosyan(tennis) | 2009-02-01T21:56:37.000Z |
⤷PIBI(D)S syndrome | 2009-01-31T16:55:41.000Z |
⤷PC(SFIC)RM | 2009-01-31T16:18:53.000Z |
⤷South african chamber for agricultural development(SACADA) | 2009-01-31T00:33:45.000Z |
⤷Crocodile Tears(novel) | 2009-01-29T21:11:45.000Z |
⤷C str() | 2009-01-29T10:22:54.000Z |
⤷Lalita(oriya film) | 2009-01-29T05:21:06.000Z |
⤷James Brady(columnist) | 2009-01-28T16:12:31.000Z |
⤷Ultimate Spinach(album) | 2009-01-28T15:51:31.000Z |
⤷Paris(Paris Hilton album) | 2009-01-27T23:50:51.000Z |
⤷List of number one hits of 2009(FIMI-italian Download chart) | 2009-01-27T20:59:16.000Z |
⤷It's Me...(Remix) | 2009-01-27T18:03:06.000Z |
⤷Gran Premio Jockey Club(Uruguay) | 2009-01-27T09:50:44.000Z |
⤷Check clearing(finance) | 2009-01-26T21:34:46.000Z |
⤷Robert E. Yates(politician) | 2009-01-26T21:25:41.000Z |
⤷Chowwannur(Village) | 2009-01-26T12:25:51.000Z |
⤷Sajid Khan(director) | 2009-01-26T09:54:54.000Z |
⤷PCP(R) | 2009-01-26T01:47:03.000Z |
⤷PCdelP(m-l) | 2009-01-26T00:36:18.000Z |
⤷PCP(BR) | 2009-01-25T23:33:10.000Z |
⤷Hard tail(guitar) | 2009-01-25T20:35:40.000Z |
⤷PC(ml)P | 2009-01-25T19:02:09.000Z |
⤷ORPC(ML) | 2009-01-25T17:24:56.000Z |
⤷Veneer(dentistry) | 2009-01-25T10:05:43.000Z |
⤷Dichlorobis(ethylenediamine)nickel II | 2009-01-25T06:34:59.000Z |
⤷Disconnected (Out of Touch)(Trapt song) | 2009-01-23T17:58:49.000Z |
⤷Violet(Seal song) | 2009-01-23T07:06:41.000Z |
⤷Adam Williams(Basketball Player) | 2009-01-23T05:13:06.000Z |
⤷Chr(0) | 2009-01-23T04:10:14.000Z |
⤷Hello Dollie(TV series) | 2009-01-22T13:08:23.000Z |
⤷Germanium(IV) sulfide | 2009-01-21T14:33:26.000Z |
⤷Gallium(III) phosphide | 2009-01-21T14:09:36.000Z |
⤷Gallium(III) nitride | 2009-01-21T14:03:59.000Z |
⤷Harlem Heights(TV series) | 2009-01-21T04:50:50.000Z |
⤷AAPL(NASDAQ) | 2009-01-20T20:29:46.000Z |
⤷Pb(SCN)2 | 2009-01-20T17:28:43.000Z |
Lead(II) thiocyanate | 2009-01-20T14:21:03.000Z |
⤷XT(2) | 2009-01-20T09:00:58.000Z |
⤷All Power to the People(film) | 2009-01-20T07:39:13.000Z |
⤷Gábor Horváth (footballer)(born 1985) | 2009-01-20T03:34:03.000Z |
⤷For(N)ever | 2009-01-19T17:39:00.000Z |
We Are One(concert) | 2009-01-19T07:32:28.000Z |
⤷Pt(CN)42- | 2009-01-18T20:15:17.000Z |
⤷The Story So Far...(Mostly Autumn album) | 2009-01-18T08:47:05.000Z |
⤷Energoatom(Russia) | 2009-01-17T14:01:47.000Z |
⤷Energoatom(Ukraine) | 2009-01-17T13:59:59.000Z |
⤷Ruthenium tris(bipyridine) dichloride | 2009-01-17T12:08:00.000Z |
⤷Patrick Moran(Irish Republican) | 2009-01-17T09:39:36.000Z |
⤷Hannah Smith(1897-1960) | 2009-01-17T00:33:45.000Z |
⤷Dear...(Fukada Kyoko) | 2009-01-16T19:18:18.000Z |
⤷Orphans(song) | 2009-01-16T16:50:49.000Z |
Al Said(yacht) | 2009-01-16T15:43:58.000Z |
⤷Two Weeks(All That Remains song) | 2009-01-16T04:50:46.000Z |
⤷Sirivennala Seetha Rama Sastry(Poet and Lyricist) | 2009-01-15T12:18:30.000Z |
⤷3,3'-Dithiobis(6-nitrobenzoic acid) | 2009-01-15T04:41:06.000Z |
⤷Purin-6(1H)-one | 2009-01-15T04:09:22.000Z |
⤷Rodrigo Prieto(soccer) | 2009-01-14T23:55:36.000Z |
⤷Enur(Group) | 2009-01-14T21:24:44.000Z |
⤷Tungsten(VI) fluoride | 2009-01-11T21:28:33.000Z |
⤷H.1(Isle of Man Railway) | 2009-01-11T21:21:16.000Z |
⤷New Moon(film) | 2009-01-11T20:22:26.000Z |
⤷CKUE-FM-1(2) | 2009-01-10T22:52:35.000Z |
∑ 1000 items on this page | Query runtime: 5.35 s | Last updated: 4 February 2024 22:26 (UTC) << Previous page || Next page >>